C8H17NO2 — CID 164532769
ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane (PubChem CID 164532769) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane.
| Compound Name | ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 164532769 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane |
| SMILES | CC.CN1CC2(C1)OCCO2 |
| InChI | InChI=1S/C6H11NO2.C2H6/c1-7-4-6(5-7)8-2-3-9-6;1-2/h2-5H2,1H3;1-2H3 |
| InChIKey | CHLJQYRDGZBHLR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |