About ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane
ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane (PubChem CID 164532769) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane.
Molecular Properties
| Compound Name | ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane |
| PubChem CID | 164532769 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane |
| SMILES | CC.CN1CC2(C1)OCCO2 |
| InChI | InChI=1S/C6H11NO2.C2H6/c1-7-4-6(5-7)8-2-3-9-6;1-2/h2-5H2,1H3;1-2H3 |
| InChIKey | CHLJQYRDGZBHLR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane?
The IUPAC name of ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane (CID 164532769) is ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane.
What is the SMILES notation for ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane?
The canonical SMILES for ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane is CC.CN1CC2(C1)OCCO2.
What is the InChIKey of ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane?
The InChIKey is CHLJQYRDGZBHLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.C2H6/c1-7-4-6(5-7)8-2-3-9-6;1-2/h2-5H2,1H3;1-2H3.
What are the key properties of ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane?
ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane has a molecular weight of 159.23 g/mol, XLogP of 0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-5,8-dioxa-2-azaspiro[3.4]octane is sourced from PubChem (CID 164532769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).