About 3-fluoro-1,3-dimethylazetidine
3-fluoro-1,3-dimethylazetidine (PubChem CID 89296536) has the molecular formula C5H10FN
and a molecular weight of 103.14 g/mol. Its IUPAC name is 3-fluoro-1,3-dimethylazetidine.
Molecular Properties
| Compound Name | 3-fluoro-1,3-dimethylazetidine |
| PubChem CID | 89296536 |
| Molecular Formula | C5H10FN |
| Molecular Weight | 103.14 g/mol |
| Exact Mass | 103.08 |
| IUPAC Name | 3-fluoro-1,3-dimethylazetidine |
| SMILES | CN1CC(C)(F)C1 |
| InChI | InChI=1S/C5H10FN/c1-5(6)3-7(2)4-5/h3-4H2,1-2H3 |
| InChIKey | CTOOUTTXJCCPQY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.14 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-1,3-dimethylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1,3-dimethylazetidine?
The IUPAC name of 3-fluoro-1,3-dimethylazetidine (CID 89296536) is 3-fluoro-1,3-dimethylazetidine.
What is the SMILES notation for 3-fluoro-1,3-dimethylazetidine?
The canonical SMILES for 3-fluoro-1,3-dimethylazetidine is CN1CC(C)(F)C1.
What is the InChIKey of 3-fluoro-1,3-dimethylazetidine?
The InChIKey is CTOOUTTXJCCPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10FN/c1-5(6)3-7(2)4-5/h3-4H2,1-2H3.
What are the key properties of 3-fluoro-1,3-dimethylazetidine?
3-fluoro-1,3-dimethylazetidine has a molecular weight of 103.14 g/mol, XLogP of 0.66, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1,3-dimethylazetidine is sourced from PubChem (CID 89296536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).