About (2-methyl-5,8-dioxa-2-azaspiro[3.4]octan-7-yl)methanol
(2-methyl-5,8-dioxa-2-azaspiro[3.4]octan-7-yl)methanol (PubChem CID 22967026) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is (2-methyl-5,8-dioxa-2-azaspiro[3.4]octan-7-yl)methanol.
Analyze (2-methyl-5,8-dioxa-2-azaspiro[3.4]octan-7-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-5,8-dioxa-2-azaspiro[3.4]octan-7-yl)methanol?
The IUPAC name of (2-methyl-5,8-dioxa-2-azaspiro[3.4]octan-7-yl)methanol (CID 22967026) is (2-methyl-5,8-dioxa-2-azaspiro[3.4]octan-7-yl)methanol.
What is the SMILES notation for (2-methyl-5,8-dioxa-2-azaspiro[3.4]octan-7-yl)methanol?
The canonical SMILES for (2-methyl-5,8-dioxa-2-azaspiro[3.4]octan-7-yl)methanol is CN1CC2(C1)OCC(CO)O2.
What is the InChIKey of (2-methyl-5,8-dioxa-2-azaspiro[3.4]octan-7-yl)methanol?
The InChIKey is XTJGWBTZCUKIHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-8-4-7(5-8)10-3-6(2-9)11-7/h6,9H,2-5H2,1H3.
What are the key properties of (2-methyl-5,8-dioxa-2-azaspiro[3.4]octan-7-yl)methanol?
(2-methyl-5,8-dioxa-2-azaspiro[3.4]octan-7-yl)methanol has a molecular weight of 159.18 g/mol, XLogP of -0.96, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-5,8-dioxa-2-azaspiro[3.4]octan-7-yl)methanol is sourced from PubChem (CID 22967026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).