C12H27NO2 — CID 144742109
ethane;7-ethyl-2-methyl-5,8-dioxa-2-azaspiro[3.4]octane (PubChem CID 144742109) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is ethane;7-ethyl-2-methyl-5,8-dioxa-2-azaspiro[3.4]octane.
| Compound Name | ethane;7-ethyl-2-methyl-5,8-dioxa-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 144742109 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | ethane;7-ethyl-2-methyl-5,8-dioxa-2-azaspiro[3.4]octane |
| SMILES | CC.CC.CCC1COC2(CN(C)C2)O1 |
| InChI | InChI=1S/C8H15NO2.2C2H6/c1-3-7-4-10-8(11-7)5-9(2)6-8;2*1-2/h7H,3-6H2,1-2H3;2*1-2H3 |
| InChIKey | KDNITSPCZFMGGQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |