C11H24O2 — CID 144903922
1,4-dioxaspiro[4.4]nonane;ethane (PubChem CID 144903922) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.4]nonane;ethane.
| Compound Name | 1,4-dioxaspiro[4.4]nonane;ethane |
|---|---|
| PubChem CID | 144903922 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | 1,4-dioxaspiro[4.4]nonane;ethane |
| SMILES | C1CCC2(C1)OCCO2.CC.CC |
| InChI | InChI=1S/C7H12O2.2C2H6/c1-2-4-7(3-1)8-5-6-9-7;2*1-2/h1-6H2;2*1-2H3 |
| InChIKey | IDFAAPUJPSLZQW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |