C11H22O3 — CID 143931263
ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-ol (PubChem CID 143931263) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-ol.
| Compound Name | ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 143931263 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | ethane;8-methyl-1,4-dioxaspiro[4.5]decan-8-ol |
| SMILES | CC.CC1(O)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C9H16O3.C2H6/c1-8(10)2-4-9(5-3-8)11-6-7-12-9;1-2/h10H,2-7H2,1H3;1-2H3 |
| InChIKey | CFMHPDVKOUESCE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |