C12H20O2 — CID 175914993
12,12-dimethyl-7,10-dioxadispiro[2.2.46.23]dodecane (PubChem CID 175914993) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 12,12-dimethyl-7,10-dioxadispiro[2.2.46.23]dodecane.
| Compound Name | 12,12-dimethyl-7,10-dioxadispiro[2.2.46.23]dodecane |
|---|---|
| PubChem CID | 175914993 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 12,12-dimethyl-7,10-dioxadispiro[2.2.46.23]dodecane |
| SMILES | CC1(C)CC2(CCC13CC3)OCCO2 |
| InChI | InChI=1S/C12H20O2/c1-10(2)9-12(13-7-8-14-12)6-5-11(10)3-4-11/h3-9H2,1-2H3 |
| InChIKey | HSFLZYJLSMIHOP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |