C11H20O3 — CID 121222293
2-(7-methyl-1,4-dioxaspiro[4.5]decan-7-yl)ethanol (PubChem CID 121222293) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-(7-methyl-1,4-dioxaspiro[4.5]decan-7-yl)ethanol.
| Compound Name | 2-(7-methyl-1,4-dioxaspiro[4.5]decan-7-yl)ethanol |
|---|---|
| PubChem CID | 121222293 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-(7-methyl-1,4-dioxaspiro[4.5]decan-7-yl)ethanol |
| SMILES | CC1(CCO)CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C11H20O3/c1-10(5-6-12)3-2-4-11(9-10)13-7-8-14-11/h12H,2-9H2,1H3 |
| InChIKey | QPUOEAWEDODDGW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |