C9H16O3 — CID 13363042
[(2S,5S)-1,10-dioxaspiro[4.5]decan-2-yl]methanol (PubChem CID 13363042) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is [(2S,5S)-1,10-dioxaspiro[4.5]decan-2-yl]methanol.
| Compound Name | [(2S,5S)-1,10-dioxaspiro[4.5]decan-2-yl]methanol |
|---|---|
| PubChem CID | 13363042 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | [(2S,5S)-1,10-dioxaspiro[4.5]decan-2-yl]methanol |
| SMILES | OC[C@@H]1CC[C@]2(CCCCO2)O1 |
| InChI | InChI=1S/C9H16O3/c10-7-8-3-5-9(12-8)4-1-2-6-11-9/h8,10H,1-7H2/t8-,9-/m0/s1 |
| InChIKey | IFLBNNFVGHJPRK-IUCAKERBSA-N |
| XLogP | 1.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |