C13H22O3 — CID 10443702
2-(oxan-2-yl)-1,10-dioxaspiro[4.5]decane (PubChem CID 10443702) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-(oxan-2-yl)-1,10-dioxaspiro[4.5]decane.
| Compound Name | 2-(oxan-2-yl)-1,10-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 10443702 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 2-(oxan-2-yl)-1,10-dioxaspiro[4.5]decane |
| SMILES | C1CCC(C2CCC3(CCCCO3)O2)OC1 |
| InChI | InChI=1S/C13H22O3/c1-3-9-14-11(5-1)12-6-8-13(16-12)7-2-4-10-15-13/h11-12H,1-10H2 |
| InChIKey | KEASJOCRKLQHRL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |