C12H20O3 — CID 154992073
(5R,7S)-7-methylspiro[2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5,2'-oxane] (PubChem CID 154992073) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (5R,7S)-7-methylspiro[2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5,2'-oxane].
| Compound Name | (5R,7S)-7-methylspiro[2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5,2'-oxane] |
|---|---|
| PubChem CID | 154992073 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (5R,7S)-7-methylspiro[2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5,2'-oxane] |
| SMILES | C[C@H]1C[C@@]2(CCCCO2)OC2CCOC21 |
| InChI | InChI=1S/C12H20O3/c1-9-8-12(5-2-3-6-14-12)15-10-4-7-13-11(9)10/h9-11H,2-8H2,1H3/t9-,10?,11?,12+/m0/s1 |
| InChIKey | BUNDSPIQFUWGCY-WNYYMSAVSA-N |
| XLogP | 2.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |