C13H24NO3+ — CID 139206681
(3S)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2-dimethyl-1,2-oxazolidin-2-ium (PubChem CID 139206681) has the molecular formula C13H24NO3+ and a molecular weight of 242.34 g/mol. Its IUPAC name is (3S)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2-dimethyl-1,2-oxazolidin-2-ium.
| Compound Name | (3S)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2-dimethyl-1,2-oxazolidin-2-ium |
|---|---|
| PubChem CID | 139206681 |
| Molecular Formula | C13H24NO3+ |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (3S)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-2,2-dimethyl-1,2-oxazolidin-2-ium |
| SMILES | C[N+]1(C)OCC[C@H]1[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C13H24NO3/c1-14(2)11(6-9-16-14)12-10-15-13(17-12)7-4-3-5-8-13/h11-12H,3-10H2,1-2H3/q+1/t11-,12+/m0/s1 |
| InChIKey | PTKDMIXOXDKWRQ-NWDGAFQWSA-N |
| XLogP | 1.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|