C19H30O5 — CID 70790447
CID 70790447 (PubChem CID 70790447) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol.
| Compound Name | CID 70790447 |
|---|---|
| PubChem CID | 70790447 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | — |
| SMILES | C1CCCC2(CC1)O[C@@H]1O[C@@H]3COC4(CCCCCC4)O[C@H]3[C@@H]1O2 |
| InChI | InChI=1S/C19H30O5/c1-2-6-10-18(9-5-1)20-13-14-15(22-18)16-17(21-14)24-19(23-16)11-7-3-4-8-12-19/h14-17H,1-13H2/t14-,15-,16+,17+/m1/s1 |
| InChIKey | ZORVRHHDHJSKCQ-NCOADZHNSA-N |
| XLogP | 3.64 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |