C12H19O5PS — CID 102057393
(1S,2R,6R,8R)-11-methyl-11-sulfanylidenespiro[3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane-4,1'-cyclohexane] (PubChem CID 102057393) has the molecular formula C12H19O5PS and a molecular weight of 306.32 g/mol. Its IUPAC name is (1S,2R,6R,8R)-11-methyl-11-sulfanylidenespiro[3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane-4,1'-cyclohexane].
| Compound Name | (1S,2R,6R,8R)-11-methyl-11-sulfanylidenespiro[3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane-4,1'-cyclohexane] |
|---|---|
| PubChem CID | 102057393 |
| Molecular Formula | C12H19O5PS |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (1S,2R,6R,8R)-11-methyl-11-sulfanylidenespiro[3,5,7,10,12-pentaoxa-11λ5-phosphatricyclo[6.4.0.02,6]dodecane-4,1'-cyclohexane] |
| SMILES | CP1(=S)OC[C@H]2O[C@@H]3OC4(CCCCC4)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C12H19O5PS/c1-18(19)13-7-8-9(17-18)10-11(14-8)16-12(15-10)5-3-2-4-6-12/h8-11H,2-7H2,1H3/t8-,9+,10-,11-,18?/m1/s1 |
| InChIKey | ZVYWCHPTECOHAZ-RIXIXXQWSA-N |
| XLogP | 2.14 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|