About CID 11893070
CID 11893070 (PubChem CID 11893070) has the molecular formula C18H25O7-
and a molecular weight of 353.39 g/mol.
Molecular Properties
| Compound Name | CID 11893070 |
| PubChem CID | 11893070 |
| Molecular Formula | C18H25O7- |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | — |
| SMILES | O=C([O-])[C@@H]1O[C@H]2OC3(CCCCC3)O[C@@H]2[C@H]2OC3(CCCCC3)O[C@H]21 |
| InChI | InChI=1S/C18H26O7/c19-15(20)13-11-12(23-17(22-11)7-3-1-4-8-17)14-16(21-13)25-18(24-14)9-5-2-6-10-18/h11-14,16H,1-10H2,(H,19,20)/p-1/t11-,12+,13-,14-,16+/m1/s1 |
| InChIKey | DKIDUEFGXKKXNI-SGPHBRAGSA-M |
| XLogP | 0.98 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 11893070 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11893070?
The IUPAC name of CID 11893070 (CID 11893070) is not available.
What is the SMILES notation for CID 11893070?
The canonical SMILES for CID 11893070 is O=C([O-])[C@@H]1O[C@H]2OC3(CCCCC3)O[C@@H]2[C@H]2OC3(CCCCC3)O[C@H]21.
What is the InChIKey of CID 11893070?
The InChIKey is DKIDUEFGXKKXNI-SGPHBRAGSA-M. The full InChI is InChI=1S/C18H26O7/c19-15(20)13-11-12(23-17(22-11)7-3-1-4-8-17)14-16(21-13)25-18(24-14)9-5-2-6-10-18/h11-14,16H,1-10H2,(H,19,20)/p-1/t11-,12+,13-,14-,16+/m1/s1.
What are the key properties of CID 11893070?
CID 11893070 has a molecular weight of 353.39 g/mol, XLogP of 0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11893070 is sourced from PubChem (CID 11893070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).