C24H29Cl2NO6 — CID 124775567
CID 124775567 (PubChem CID 124775567) has the molecular formula C24H29Cl2NO6 and a molecular weight of 498.40 g/mol.
| Compound Name | CID 124775567 |
|---|---|
| PubChem CID | 124775567 |
| Molecular Formula | C24H29Cl2NO6 |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | — |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)[C@@H]1O[C@@H]2OC3(CCCCC3)O[C@@H]2[C@H]2OC3(CCCCC3)O[C@H]21 |
| InChI | InChI=1S/C24H29Cl2NO6/c25-15-8-7-14(13-16(15)26)27-21(28)19-17-18(31-23(30-17)9-3-1-4-10-23)20-22(29-19)33-24(32-20)11-5-2-6-12-24/h7-8,13,17-20,22H,1-6,9-12H2,(H,27,28)/t17-,18+,19-,20-,22-/m1/s1 |
| InChIKey | PUWATNRSCWZXSO-AIYVTKCESA-N |
| XLogP | 5.18 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |