C19H24ClNO7 — CID 42223582
(1R,2R,6S,8S,9S)-N-(5-chloro-2-methoxyphenyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 42223582) has the molecular formula C19H24ClNO7 and a molecular weight of 413.85 g/mol. Its IUPAC name is (1R,2R,6S,8S,9S)-N-(5-chloro-2-methoxyphenyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | (1R,2R,6S,8S,9S)-N-(5-chloro-2-methoxyphenyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 42223582 |
| Molecular Formula | C19H24ClNO7 |
| Molecular Weight | 413.85 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (1R,2R,6S,8S,9S)-N-(5-chloro-2-methoxyphenyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)[C@H]1O[C@H]2OC(C)(C)O[C@@H]2[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C19H24ClNO7/c1-18(2)25-12-13(26-18)15-17(28-19(3,4)27-15)24-14(12)16(22)21-10-8-9(20)6-7-11(10)23-5/h6-8,12-15,17H,1-5H3,(H,21,22)/t12-,13+,14-,15+,17-/m0/s1 |
| InChIKey | FOLIWIHHCQEVHR-SVZOTFJBSA-N |
| XLogP | 2.68 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.85 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |