C19H22F3NO6 — CID 7223116
(1S,2S,6S,8R,9R)-4,4,11,11-tetramethyl-N-[2-(trifluoromethyl)phenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 7223116) has the molecular formula C19H22F3NO6 and a molecular weight of 417.38 g/mol. Its IUPAC name is (1S,2S,6S,8R,9R)-4,4,11,11-tetramethyl-N-[2-(trifluoromethyl)phenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | (1S,2S,6S,8R,9R)-4,4,11,11-tetramethyl-N-[2-(trifluoromethyl)phenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 7223116 |
| Molecular Formula | C19H22F3NO6 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | (1S,2S,6S,8R,9R)-4,4,11,11-tetramethyl-N-[2-(trifluoromethyl)phenyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | CC1(C)O[C@@H]2O[C@@H](C(=O)Nc3ccccc3C(F)(F)F)[C@@H]3OC(C)(C)O[C@@H]3[C@@H]2O1 |
| InChI | InChI=1S/C19H22F3NO6/c1-17(2)26-11-12(27-17)14-16(29-18(3,4)28-14)25-13(11)15(24)23-10-8-6-5-7-9(10)19(20,21)22/h5-8,11-14,16H,1-4H3,(H,23,24)/t11-,12+,13-,14+,16+/m1/s1 |
| InChIKey | GSQCRPFGOPNVJK-AQRJEWBLSA-N |
| XLogP | 3.04 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |