C25H31FN2O6 — CID 92508900
CID 92508900 (PubChem CID 92508900) has the molecular formula C25H31FN2O6 and a molecular weight of 474.53 g/mol.
| Compound Name | CID 92508900 |
|---|---|
| PubChem CID | 92508900 |
| Molecular Formula | C25H31FN2O6 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | — |
| SMILES | O=C(N/N=C\c1ccccc1F)[C@@H]1O[C@@H]2OC3(CCCCC3)O[C@@H]2[C@@H]2OC3(CCCCC3)O[C@@H]21 |
| InChI | InChI=1S/C25H31FN2O6/c26-17-10-4-3-9-16(17)15-27-28-22(29)20-18-19(32-24(31-18)11-5-1-6-12-24)21-23(30-20)34-25(33-21)13-7-2-8-14-25/h3-4,9-10,15,18-21,23H,1-2,5-8,11-14H2,(H,28,29)/b27-15-/t18-,19+,20+,21+,23+/m0/s1 |
| InChIKey | GPGJEJUNCOOXHD-RESMUOTISA-N |
| XLogP | 3.52 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|