C31H45NO7 — CID 98399642
CID 98399642 (PubChem CID 98399642) has the molecular formula C31H45NO7 and a molecular weight of 543.70 g/mol.
| Compound Name | CID 98399642 |
|---|---|
| PubChem CID | 98399642 |
| Molecular Formula | C31H45NO7 |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.32 |
| IUPAC Name | — |
| SMILES | CCCCCCCOc1ccc(NC(=O)[C@@H]2O[C@H]3OC4(CCCCC4)O[C@@H]3[C@H]3OC4(CCCCC4)O[C@H]32)cc1 |
| InChI | InChI=1S/C31H45NO7/c1-2-3-4-5-12-21-34-23-15-13-22(14-16-23)32-28(33)26-24-25(37-30(36-24)17-8-6-9-18-30)27-29(35-26)39-31(38-27)19-10-7-11-20-31/h13-16,24-27,29H,2-12,17-21H2,1H3,(H,32,33)/t24-,25+,26-,27-,29+/m1/s1 |
| InChIKey | RLUWEDUUYKGLSD-DBDYDPBISA-N |
| XLogP | 6.22 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|