C25H37NO7 — CID 163052767
(1S,2S,6R,8R,9S)-N-(4-heptoxyphenyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 163052767) has the molecular formula C25H37NO7 and a molecular weight of 463.57 g/mol. Its IUPAC name is (1S,2S,6R,8R,9S)-N-(4-heptoxyphenyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | (1S,2S,6R,8R,9S)-N-(4-heptoxyphenyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 163052767 |
| Molecular Formula | C25H37NO7 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | (1S,2S,6R,8R,9S)-N-(4-heptoxyphenyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | CCCCCCCOc1ccc(NC(=O)[C@@H]2O[C@@H]3OC(C)(C)O[C@H]3[C@H]3OC(C)(C)O[C@@H]32)cc1 |
| InChI | InChI=1S/C25H37NO7/c1-6-7-8-9-10-15-28-17-13-11-16(12-14-17)26-22(27)20-18-19(31-24(2,3)30-18)21-23(29-20)33-25(4,5)32-21/h11-14,18-21,23H,6-10,15H2,1-5H3,(H,26,27)/t18-,19-,20+,21-,23+/m0/s1 |
| InChIKey | XDPZRTZZFOLITE-KHYDEXNFSA-N |
| XLogP | 4.37 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|