C26H40N2O7 — CID 11712920
[(E)-[(3aR,5R,6S,6aR)-6-decoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylideneamino] N-(4-methoxyphenyl)carbamate (PubChem CID 11712920) has the molecular formula C26H40N2O7 and a molecular weight of 492.61 g/mol. Its IUPAC name is [(E)-[(3aR,5R,6S,6aR)-6-decoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylideneamino] N-(4-methoxyphenyl)carbamate.
| Compound Name | [(E)-[(3aR,5R,6S,6aR)-6-decoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylideneamino] N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 11712920 |
| Molecular Formula | C26H40N2O7 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | [(E)-[(3aR,5R,6S,6aR)-6-decoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylideneamino] N-(4-methoxyphenyl)carbamate |
| SMILES | CCCCCCCCCCO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1/C=N/OC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H40N2O7/c1-5-6-7-8-9-10-11-12-17-31-22-21(32-24-23(22)33-26(2,3)34-24)18-27-35-25(29)28-19-13-15-20(30-4)16-14-19/h13-16,18,21-24H,5-12,17H2,1-4H3,(H,28,29)/b27-18+/t21-,22+,23-,24-/m1/s1 |
| InChIKey | ZBQNPCABVWXVGX-JWMAOWMQSA-N |
| XLogP | 5.63 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|