C23H34N2O7 — CID 11583245
[(E)-[(3aS,4S,6R,6aS)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylideneamino] N-(4-methoxyphenyl)carbamate (PubChem CID 11583245) has the molecular formula C23H34N2O7 and a molecular weight of 450.53 g/mol. Its IUPAC name is [(E)-[(3aS,4S,6R,6aS)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylideneamino] N-(4-methoxyphenyl)carbamate.
| Compound Name | [(E)-[(3aS,4S,6R,6aS)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylideneamino] N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 11583245 |
| Molecular Formula | C23H34N2O7 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | [(E)-[(3aS,4S,6R,6aS)-4-heptoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methylideneamino] N-(4-methoxyphenyl)carbamate |
| SMILES | CCCCCCCO[C@H]1O[C@H](/C=N/OC(=O)Nc2ccc(OC)cc2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C23H34N2O7/c1-5-6-7-8-9-14-28-21-20-19(30-23(2,3)31-20)18(29-21)15-24-32-22(26)25-16-10-12-17(27-4)13-11-16/h10-13,15,18-21H,5-9,14H2,1-4H3,(H,25,26)/b24-15+/t18-,19+,20+,21+/m1/s1 |
| InChIKey | YOXXBKPUPWSATC-OVRIJCLRSA-N |
| XLogP | 4.46 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|