C24H29F3N2O3 — CID 20872776
[(E)-[4-(trifluoromethyl)phenyl]methylideneamino] N-(4-nonoxyphenyl)carbamate (PubChem CID 20872776) has the molecular formula C24H29F3N2O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is [(E)-[4-(trifluoromethyl)phenyl]methylideneamino] N-(4-nonoxyphenyl)carbamate.
| Compound Name | [(E)-[4-(trifluoromethyl)phenyl]methylideneamino] N-(4-nonoxyphenyl)carbamate |
|---|---|
| PubChem CID | 20872776 |
| Molecular Formula | C24H29F3N2O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | [(E)-[4-(trifluoromethyl)phenyl]methylideneamino] N-(4-nonoxyphenyl)carbamate |
| SMILES | CCCCCCCCCOc1ccc(NC(=O)O/N=C/c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H29F3N2O3/c1-2-3-4-5-6-7-8-17-31-22-15-13-21(14-16-22)29-23(30)32-28-18-19-9-11-20(12-10-19)24(25,26)27/h9-16,18H,2-8,17H2,1H3,(H,29,30)/b28-18+ |
| InChIKey | KZKCCZVJTAPLJH-MTDXEUNCSA-N |
| XLogP | 7.42 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|