C18H19FN2O3 — CID 20872751
[(E)-(4-fluorophenyl)methylideneamino] N-(4-butoxyphenyl)carbamate (PubChem CID 20872751) has the molecular formula C18H19FN2O3 and a molecular weight of 330.36 g/mol. Its IUPAC name is [(E)-(4-fluorophenyl)methylideneamino] N-(4-butoxyphenyl)carbamate.
| Compound Name | [(E)-(4-fluorophenyl)methylideneamino] N-(4-butoxyphenyl)carbamate |
|---|---|
| PubChem CID | 20872751 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | [(E)-(4-fluorophenyl)methylideneamino] N-(4-butoxyphenyl)carbamate |
| SMILES | CCCCOc1ccc(NC(=O)O/N=C/c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H19FN2O3/c1-2-3-12-23-17-10-8-16(9-11-17)21-18(22)24-20-13-14-4-6-15(19)7-5-14/h4-11,13H,2-3,12H2,1H3,(H,21,22)/b20-13+ |
| InChIKey | TUBGAHMSUYZNEG-DEDYPNTBSA-N |
| XLogP | 4.59 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|