C13H21NO5 — CID 11054777
(NE)-N-[[(3aR,5S,6R,6aR)-2,2-dimethyl-6-(3-methylbut-2-enoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylidene]hydroxylamine (PubChem CID 11054777) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is (NE)-N-[[(3aR,5S,6R,6aR)-2,2-dimethyl-6-(3-methylbut-2-enoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[(3aR,5S,6R,6aR)-2,2-dimethyl-6-(3-methylbut-2-enoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 11054777 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (NE)-N-[[(3aR,5S,6R,6aR)-2,2-dimethyl-6-(3-methylbut-2-enoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylidene]hydroxylamine |
| SMILES | CC(C)=CCO[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@H]1/C=N/O |
| InChI | InChI=1S/C13H21NO5/c1-8(2)5-6-16-10-9(7-14-15)17-12-11(10)18-13(3,4)19-12/h5,7,9-12,15H,6H2,1-4H3/b14-7+/t9-,10+,11+,12+/m0/s1 |
| InChIKey | QRIATQMILSXPPK-ZLABXNKNSA-N |
| XLogP | 1.67 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|