C20H28O5 — CID 102259057
[(3aR,5S,6R,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-[(1S,2S,4S)-2,4-bis(ethenyl)cyclopentyl]methanone (PubChem CID 102259057) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-[(1S,2S,4S)-2,4-bis(ethenyl)cyclopentyl]methanone.
| Compound Name | [(3aR,5S,6R,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-[(1S,2S,4S)-2,4-bis(ethenyl)cyclopentyl]methanone |
|---|---|
| PubChem CID | 102259057 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(3aR,5S,6R,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-[(1S,2S,4S)-2,4-bis(ethenyl)cyclopentyl]methanone |
| SMILES | C=CCO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C(=O)[C@H]1C[C@@H](C=C)C[C@H]1C=C |
| InChI | InChI=1S/C20H28O5/c1-6-9-22-17-16(23-19-18(17)24-20(4,5)25-19)15(21)14-11-12(7-2)10-13(14)8-3/h6-8,12-14,16-19H,1-3,9-11H2,4-5H3/t12-,13+,14-,16+,17-,18+,19+/m0/s1 |
| InChIKey | MEWGJPTVQJNLQA-WDBLWHFESA-N |
| XLogP | 3.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|