C14H18O5 — CID 46243605
1-[(3aR,5S,6R,6aR)-6-but-2-ynoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-en-1-one (PubChem CID 46243605) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 1-[(3aR,5S,6R,6aR)-6-but-2-ynoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-en-1-one.
| Compound Name | 1-[(3aR,5S,6R,6aR)-6-but-2-ynoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46243605 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 1-[(3aR,5S,6R,6aR)-6-but-2-ynoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCC#CC |
| InChI | InChI=1S/C14H18O5/c1-5-7-8-16-11-10(9(15)6-2)17-13-12(11)18-14(3,4)19-13/h6,10-13H,2,8H2,1,3-4H3/t10-,11+,12-,13-/m1/s1 |
| InChIKey | VKSBIPAKLISZNV-YVECIDJPSA-N |
| XLogP | 1.03 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|