C15H15Cl2FN2O — CID 6542599
trans-(1R,3R)-3-(2,2-dichloroethenyl)-N-[(Z)-(2-fluorophenyl)methylideneamino]-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 6542599) has the molecular formula C15H15Cl2FN2O and a molecular weight of 329.20 g/mol. Its IUPAC name is trans-(1R,3R)-3-(2,2-dichloroethenyl)-N-[(Z)-(2-fluorophenyl)methylideneamino]-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-3-(2,2-dichloroethenyl)-N-[(Z)-(2-fluorophenyl)methylideneamino]-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 6542599 |
| Molecular Formula | C15H15Cl2FN2O |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | trans-(1R,3R)-3-(2,2-dichloroethenyl)-N-[(Z)-(2-fluorophenyl)methylideneamino]-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)[C@H](C(=O)N/N=C\c2ccccc2F)[C@@H]1C=C(Cl)Cl |
| InChI | InChI=1S/C15H15Cl2FN2O/c1-15(2)10(7-12(16)17)13(15)14(21)20-19-8-9-5-3-4-6-11(9)18/h3-8,10,13H,1-2H3,(H,20,21)/b19-8-/t10-,13-/m0/s1 |
| InChIKey | FKTAOUGCEILMEG-JVGRSCSNSA-N |
| XLogP | 3.87 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|