C17H20Cl2N2O3 — CID 136714341
trans-(1S,3S)-3-(2,2-dichloroethenyl)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 136714341) has the molecular formula C17H20Cl2N2O3 and a molecular weight of 371.26 g/mol. Its IUPAC name is trans-(1S,3S)-3-(2,2-dichloroethenyl)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,3S)-3-(2,2-dichloroethenyl)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 136714341 |
| Molecular Formula | C17H20Cl2N2O3 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | trans-(1S,3S)-3-(2,2-dichloroethenyl)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@H]2[C@@H](C=C(Cl)Cl)C2(C)C)ccc1O |
| InChI | InChI=1S/C17H20Cl2N2O3/c1-4-24-13-7-10(5-6-12(13)22)9-20-21-16(23)15-11(8-14(18)19)17(15,2)3/h5-9,11,15,22H,4H2,1-3H3,(H,21,23)/b20-9-/t11-,15-/m1/s1 |
| InChIKey | HXJAIYPOVGPKRG-NDZJURGHSA-N |
| XLogP | 3.83 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|