C15H15Cl3N2O2 — CID 136861789
cis-(1S,3R)-N-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 136861789) has the molecular formula C15H15Cl3N2O2 and a molecular weight of 361.66 g/mol. Its IUPAC name is cis-(1S,3R)-N-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | cis-(1S,3R)-N-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 136861789 |
| Molecular Formula | C15H15Cl3N2O2 |
| Molecular Weight | 361.66 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | cis-(1S,3R)-N-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(=O)N/N=C\c1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H15Cl3N2O2/c1-15(2)10(6-12(17)18)13(15)14(22)20-19-7-8-5-9(16)3-4-11(8)21/h3-7,10,13,21H,1-2H3,(H,20,22)/b19-7-/t10-,13+/m0/s1 |
| InChIKey | WMUSZFZATXKGMS-TYBZZVDLSA-N |
| XLogP | 4.09 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.66 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|