C23H22Cl2N2O — CID 171981307
3-(2,2-dichloroethenyl)-N-[(Z)-[(Z)-1,3-diphenylprop-2-enylidene]amino]-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 171981307) has the molecular formula C23H22Cl2N2O and a molecular weight of 413.35 g/mol. Its IUPAC name is 3-(2,2-dichloroethenyl)-N-[(Z)-[(Z)-1,3-diphenylprop-2-enylidene]amino]-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | 3-(2,2-dichloroethenyl)-N-[(Z)-[(Z)-1,3-diphenylprop-2-enylidene]amino]-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 171981307 |
| Molecular Formula | C23H22Cl2N2O |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 3-(2,2-dichloroethenyl)-N-[(Z)-[(Z)-1,3-diphenylprop-2-enylidene]amino]-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)N/N=C(/C=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22Cl2N2O/c1-23(2)18(15-20(24)25)21(23)22(28)27-26-19(17-11-7-4-8-12-17)14-13-16-9-5-3-6-10-16/h3-15,18,21H,1-2H3,(H,27,28)/b14-13-,26-19- |
| InChIKey | FTRFJIXKDFRCLN-UFFIDTFCSA-N |
| XLogP | 5.81 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|