C20H19ClO — CID 57302576
3-(2,2-diphenylethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride (PubChem CID 57302576) has the molecular formula C20H19ClO and a molecular weight of 310.82 g/mol. Its IUPAC name is 3-(2,2-diphenylethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride.
| Compound Name | 3-(2,2-diphenylethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 57302576 |
| Molecular Formula | C20H19ClO |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3-(2,2-diphenylethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride |
| SMILES | CC1(C)C(C=C(c2ccccc2)c2ccccc2)C1C(=O)Cl |
| InChI | InChI=1S/C20H19ClO/c1-20(2)17(18(20)19(21)22)13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,17-18H,1-2H3 |
| InChIKey | NWAFIYXHDDVUSM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|