C14H13BrCl2O — CID 54563404
3-[2-bromo-2-(4-chlorophenyl)ethenyl]-2,2-dimethylcyclopropane-1-carbonyl chloride (PubChem CID 54563404) has the molecular formula C14H13BrCl2O and a molecular weight of 348.07 g/mol. Its IUPAC name is 3-[2-bromo-2-(4-chlorophenyl)ethenyl]-2,2-dimethylcyclopropane-1-carbonyl chloride.
| Compound Name | 3-[2-bromo-2-(4-chlorophenyl)ethenyl]-2,2-dimethylcyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 54563404 |
| Molecular Formula | C14H13BrCl2O |
| Molecular Weight | 348.07 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | 3-[2-bromo-2-(4-chlorophenyl)ethenyl]-2,2-dimethylcyclopropane-1-carbonyl chloride |
| SMILES | CC1(C)C(C=C(Br)c2ccc(Cl)cc2)C1C(=O)Cl |
| InChI | InChI=1S/C14H13BrCl2O/c1-14(2)10(12(14)13(17)18)7-11(15)8-3-5-9(16)6-4-8/h3-7,10,12H,1-2H3 |
| InChIKey | ZSDJPGXWZVFDBT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.07 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|