C14H15BrCl2O2 — CID 88726851
1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid (PubChem CID 88726851) has the molecular formula C14H15BrCl2O2 and a molecular weight of 366.08 g/mol. Its IUPAC name is 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid.
| Compound Name | 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid |
|---|---|
| PubChem CID | 88726851 |
| Molecular Formula | C14H15BrCl2O2 |
| Molecular Weight | 366.08 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid |
| SMILES | CC1(C)CC1C=C(Br)c1ccc(Cl)cc1.O=C(O)Cl |
| InChI | InChI=1S/C13H14BrCl.CHClO2/c1-13(2)8-10(13)7-12(14)9-3-5-11(15)6-4-9;2-1(3)4/h3-7,10H,8H2,1-2H3;(H,3,4) |
| InChIKey | WKPIJRGXGCVCRG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.08 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|