About 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid
1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid (PubChem CID 88726851) has the molecular formula C14H15BrCl2O2
and a molecular weight of 366.08 g/mol. Its IUPAC name is 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid.
Molecular Properties
| Compound Name | 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid |
| PubChem CID | 88726851 |
| Molecular Formula | C14H15BrCl2O2 |
| Molecular Weight | 366.08 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid |
| SMILES | CC1(C)CC1C=C(Br)c1ccc(Cl)cc1.O=C(O)Cl |
| InChI | InChI=1S/C13H14BrCl.CHClO2/c1-13(2)8-10(13)7-12(14)9-3-5-11(15)6-4-9;2-1(3)4/h3-7,10H,8H2,1-2H3;(H,3,4) |
| InChIKey | WKPIJRGXGCVCRG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.08 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid?
The IUPAC name of 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid (CID 88726851) is 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid.
What is the SMILES notation for 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid?
The canonical SMILES for 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid is CC1(C)CC1C=C(Br)c1ccc(Cl)cc1.O=C(O)Cl.
What is the InChIKey of 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid?
The InChIKey is WKPIJRGXGCVCRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrCl.CHClO2/c1-13(2)8-10(13)7-12(14)9-3-5-11(15)6-4-9;2-1(3)4/h3-7,10H,8H2,1-2H3;(H,3,4).
What are the key properties of 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid?
1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid has a molecular weight of 366.08 g/mol, XLogP of 6.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-bromo-2-(2,2-dimethylcyclopropyl)ethenyl]-4-chlorobenzene;carbonochloridic acid is sourced from PubChem (CID 88726851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).