About (2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane
(2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane (PubChem CID 88596820) has the molecular formula C7H10Br2
and a molecular weight of 253.96 g/mol. Its IUPAC name is (2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane.
Molecular Properties
| Compound Name | (2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane |
| PubChem CID | 88596820 |
| Molecular Formula | C7H10Br2 |
| Molecular Weight | 253.96 g/mol |
| Exact Mass | 251.91 |
| IUPAC Name | (2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane |
| SMILES | CC1(C)C[C@H]1C=C(Br)Br |
| InChI | InChI=1S/C7H10Br2/c1-7(2)4-5(7)3-6(8)9/h3,5H,4H2,1-2H3/t5-/m1/s1 |
| InChIKey | AJGDRDUWEWODJP-RXMQYKEDSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.96 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane?
The IUPAC name of (2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane (CID 88596820) is (2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane.
What is the SMILES notation for (2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane?
The canonical SMILES for (2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane is CC1(C)C[C@H]1C=C(Br)Br.
What is the InChIKey of (2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane?
The InChIKey is AJGDRDUWEWODJP-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H10Br2/c1-7(2)4-5(7)3-6(8)9/h3,5H,4H2,1-2H3/t5-/m1/s1.
What are the key properties of (2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane?
(2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane has a molecular weight of 253.96 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2,2-dibromoethenyl)-1,1-dimethylcyclopropane is sourced from PubChem (CID 88596820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).