About trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium
trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium (PubChem CID 59107380) has the molecular formula C9H12ClOY-
and a molecular weight of 260.55 g/mol. Its IUPAC name is trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium.
Molecular Properties
| Compound Name | trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium |
| PubChem CID | 59107380 |
| Molecular Formula | C9H12ClOY- |
| Molecular Weight | 260.55 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium |
| SMILES | C/[C-]=C\[C@@H]1[C@H](C(=O)Cl)C1(C)C.[Y] |
| InChI | InChI=1S/C9H12ClO.Y/c1-4-5-6-7(8(10)11)9(6,2)3;/h5-7H,1-3H3;/q-1;/t6-,7-;/m1./s1 |
| InChIKey | WNRJLOLTVUQXGV-ZJLYAJKPSA-N |
| XLogP | 2.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium?
The IUPAC name of trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium (CID 59107380) is trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium.
What is the SMILES notation for trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium?
The canonical SMILES for trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium is C/[C-]=C\[C@@H]1[C@H](C(=O)Cl)C1(C)C.[Y].
What is the InChIKey of trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium?
The InChIKey is WNRJLOLTVUQXGV-ZJLYAJKPSA-N. The full InChI is InChI=1S/C9H12ClO.Y/c1-4-5-6-7(8(10)11)9(6,2)3;/h5-7H,1-3H3;/q-1;/t6-,7-;/m1./s1.
What are the key properties of trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium?
trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium has a molecular weight of 260.55 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,3R)-2,2-dimethyl-3-prop-1-enylcyclopropane-1-carbonyl chloride;yttrium is sourced from PubChem (CID 59107380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).