C12H17ClO — CID 12952597
cis-(1R,3R)-3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carbonyl chloride (PubChem CID 12952597) has the molecular formula C12H17ClO and a molecular weight of 212.72 g/mol. Its IUPAC name is cis-(1R,3R)-3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carbonyl chloride.
| Compound Name | cis-(1R,3R)-3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carbonyl chloride |
|---|---|
| PubChem CID | 12952597 |
| Molecular Formula | C12H17ClO |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | cis-(1R,3R)-3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carbonyl chloride |
| SMILES | CC1(C)[C@H](C=C2CCCC2)[C@H]1C(=O)Cl |
| InChI | InChI=1S/C12H17ClO/c1-12(2)9(10(12)11(13)14)7-8-5-3-4-6-8/h7,9-10H,3-6H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | MQAGSSWNUYYWCU-ZJUUUORDSA-N |
| XLogP | 3.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|