C19H19F5O2 — CID 88741315
(2,3,4,5,6-pentafluorophenyl)methyl 3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 88741315) has the molecular formula C19H19F5O2 and a molecular weight of 374.35 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl 3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl 3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88741315 |
| Molecular Formula | C19H19F5O2 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl 3-(cyclopentylidenemethyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C=C2CCCC2)C1C(=O)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H19F5O2/c1-19(2)11(7-9-5-3-4-6-9)12(19)18(25)26-8-10-13(20)15(22)17(24)16(23)14(10)21/h7,11-12H,3-6,8H2,1-2H3 |
| InChIKey | JCTLULAAPFKRBF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|