C18H17F7O3 — CID 175504935
[2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 2,2-dimethyl-3-(2,3,3-trifluoroprop-1-enyl)cyclopropane-1-carboxylate (PubChem CID 175504935) has the molecular formula C18H17F7O3 and a molecular weight of 414.32 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 2,2-dimethyl-3-(2,3,3-trifluoroprop-1-enyl)cyclopropane-1-carboxylate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 2,2-dimethyl-3-(2,3,3-trifluoroprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 175504935 |
| Molecular Formula | C18H17F7O3 |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 2,2-dimethyl-3-(2,3,3-trifluoroprop-1-enyl)cyclopropane-1-carboxylate |
| SMILES | COCc1c(F)c(F)c(COC(=O)C2C(C=C(F)C(F)F)C2(C)C)c(F)c1F |
| InChI | InChI=1S/C18H17F7O3/c1-18(2)9(4-10(19)16(24)25)11(18)17(26)28-6-8-14(22)12(20)7(5-27-3)13(21)15(8)23/h4,9,11,16H,5-6H2,1-3H3 |
| InChIKey | ANYIBKMFPARMRF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|