C17H14F8O3 — CID 150247491
cis-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl (1S,3R)-2,2-dimethyl-3-(2,3,3,3-tetrafluoroprop-1-enyl)cyclopropane-1-carboxylate (PubChem CID 150247491) has the molecular formula C17H14F8O3 and a molecular weight of 418.28 g/mol. Its IUPAC name is cis-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl (1S,3R)-2,2-dimethyl-3-(2,3,3,3-tetrafluoroprop-1-enyl)cyclopropane-1-carboxylate.
| Compound Name | cis-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl (1S,3R)-2,2-dimethyl-3-(2,3,3,3-tetrafluoroprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 150247491 |
| Molecular Formula | C17H14F8O3 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | cis-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl (1S,3R)-2,2-dimethyl-3-(2,3,3,3-tetrafluoroprop-1-enyl)cyclopropane-1-carboxylate |
| SMILES | COc1c(F)c(F)c(COC(=O)[C@H]2[C@H](C=C(F)C(F)(F)F)C2(C)C)c(F)c1F |
| InChI | InChI=1S/C17H14F8O3/c1-16(2)7(4-8(18)17(23,24)25)9(16)15(26)28-5-6-10(19)12(21)14(27-3)13(22)11(6)20/h4,7,9H,5H2,1-3H3/t7-,9+/m0/s1 |
| InChIKey | FYVCZBOXTIRVSH-IONNQARKSA-N |
| XLogP | 4.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|