C15H14F4O4 — CID 19351655
(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl 3-formyl-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 19351655) has the molecular formula C15H14F4O4 and a molecular weight of 334.27 g/mol. Its IUPAC name is (2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl 3-formyl-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl 3-formyl-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 19351655 |
| Molecular Formula | C15H14F4O4 |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl 3-formyl-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | COc1c(F)c(F)c(COC(=O)C2C(C=O)C2(C)C)c(F)c1F |
| InChI | InChI=1S/C15H14F4O4/c1-15(2)7(4-20)8(15)14(21)23-5-6-9(16)11(18)13(22-3)12(19)10(6)17/h4,7-8H,5H2,1-3H3 |
| InChIKey | BEAXSJNNMVXLOS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|