C18H18F4O4 — CID 74019562
(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl 2,2-dimethyl-3-(2-methyl-3-oxoprop-1-enyl)cyclopropane-1-carboxylate (PubChem CID 74019562) has the molecular formula C18H18F4O4 and a molecular weight of 374.33 g/mol. Its IUPAC name is (2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl 2,2-dimethyl-3-(2-methyl-3-oxoprop-1-enyl)cyclopropane-1-carboxylate.
| Compound Name | (2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl 2,2-dimethyl-3-(2-methyl-3-oxoprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 74019562 |
| Molecular Formula | C18H18F4O4 |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl 2,2-dimethyl-3-(2-methyl-3-oxoprop-1-enyl)cyclopropane-1-carboxylate |
| SMILES | COc1c(F)c(F)c(COC(=O)C2C(C=C(C)C=O)C2(C)C)c(F)c1F |
| InChI | InChI=1S/C18H18F4O4/c1-8(6-23)5-10-11(18(10,2)3)17(24)26-7-9-12(19)14(21)16(25-4)15(22)13(9)20/h5-6,10-11H,7H2,1-4H3 |
| InChIKey | HGUYHWCLQAUMOG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|