C18H20F4O3 — CID 139924676
trans-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl (1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate (PubChem CID 139924676) has the molecular formula C18H20F4O3 and a molecular weight of 360.35 g/mol. Its IUPAC name is trans-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl (1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate.
| Compound Name | trans-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl (1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 139924676 |
| Molecular Formula | C18H20F4O3 |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | trans-(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl (1R,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| SMILES | COc1c(F)c(F)c(COC(=O)[C@@H]2[C@H](C=C(C)C)C2(C)C)c(F)c1F |
| InChI | InChI=1S/C18H20F4O3/c1-8(2)6-10-11(18(10,3)4)17(23)25-7-9-12(19)14(21)16(24-5)15(22)13(9)20/h6,10-11H,7H2,1-5H3/t10-,11-/m0/s1 |
| InChIKey | SZUGFMBOFSHZII-QWRGUYRKSA-N |
| XLogP | 4.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|