C22H23F4NO5 — CID 173167742
[2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 3-(2-cyano-3-oxo-3-propan-2-yloxyprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 173167742) has the molecular formula C22H23F4NO5 and a molecular weight of 457.42 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 3-(2-cyano-3-oxo-3-propan-2-yloxyprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 3-(2-cyano-3-oxo-3-propan-2-yloxyprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 173167742 |
| Molecular Formula | C22H23F4NO5 |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl 3-(2-cyano-3-oxo-3-propan-2-yloxyprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | COCc1c(F)c(F)c(COC(=O)C2C(C=C(C#N)C(=O)OC(C)C)C2(C)C)c(F)c1F |
| InChI | InChI=1S/C22H23F4NO5/c1-10(2)32-20(28)11(7-27)6-14-15(22(14,3)4)21(29)31-9-13-18(25)16(23)12(8-30-5)17(24)19(13)26/h6,10,14-15H,8-9H2,1-5H3 |
| InChIKey | KQFDOGVWMZPUFU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|