C22H23F4NO4 — CID 88902523
trans-[2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (1R,3R)-3-(2-cyano-1-prop-1-en-2-yloxyprop-2-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 88902523) has the molecular formula C22H23F4NO4 and a molecular weight of 441.42 g/mol. Its IUPAC name is trans-[2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (1R,3R)-3-(2-cyano-1-prop-1-en-2-yloxyprop-2-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-[2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (1R,3R)-3-(2-cyano-1-prop-1-en-2-yloxyprop-2-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 88902523 |
| Molecular Formula | C22H23F4NO4 |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | trans-[2,3,5,6-tetrafluoro-4-(methoxymethyl)phenyl]methyl (1R,3R)-3-(2-cyano-1-prop-1-en-2-yloxyprop-2-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | C=C(C)OC(C(=C)C#N)[C@@H]1[C@@H](C(=O)OCc2c(F)c(F)c(COC)c(F)c2F)C1(C)C |
| InChI | InChI=1S/C22H23F4NO4/c1-10(2)31-20(11(3)7-27)14-15(22(14,4)5)21(28)30-9-13-18(25)16(23)12(8-29-6)17(24)19(13)26/h14-15,20H,1,3,8-9H2,2,4-6H3/t14-,15-,20?/m0/s1 |
| InChIKey | VKACBBFEQWLKHW-HGUAOMBGSA-N |
| XLogP | 4.70 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|