C19H19F4NO3 — CID 76660828
[2,3,5,6-tetrafluoro-4-(2-hydroxyethyl)phenyl]methyl 3-(2-cyanoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 76660828) has the molecular formula C19H19F4NO3 and a molecular weight of 385.36 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(2-hydroxyethyl)phenyl]methyl 3-(2-cyanoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(2-hydroxyethyl)phenyl]methyl 3-(2-cyanoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 76660828 |
| Molecular Formula | C19H19F4NO3 |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(2-hydroxyethyl)phenyl]methyl 3-(2-cyanoprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC(C#N)=CC1C(C(=O)OCc2c(F)c(F)c(CCO)c(F)c2F)C1(C)C |
| InChI | InChI=1S/C19H19F4NO3/c1-9(7-24)6-12-13(19(12,2)3)18(26)27-8-11-16(22)14(20)10(4-5-25)15(21)17(11)23/h6,12-13,25H,4-5,8H2,1-3H3 |
| InChIKey | IOJMQUDHGRTQAD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|