C19H14F5NO2 — CID 54057060
trans-(2,3,5,6-tetrafluoro-4-propa-1,2-dienylphenyl)methyl (1R,3R)-3-(2-cyano-2-fluoroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 54057060) has the molecular formula C19H14F5NO2 and a molecular weight of 383.32 g/mol. Its IUPAC name is trans-(2,3,5,6-tetrafluoro-4-propa-1,2-dienylphenyl)methyl (1R,3R)-3-(2-cyano-2-fluoroethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-(2,3,5,6-tetrafluoro-4-propa-1,2-dienylphenyl)methyl (1R,3R)-3-(2-cyano-2-fluoroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54057060 |
| Molecular Formula | C19H14F5NO2 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | trans-(2,3,5,6-tetrafluoro-4-propa-1,2-dienylphenyl)methyl (1R,3R)-3-(2-cyano-2-fluoroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | C=C=Cc1c(F)c(F)c(COC(=O)[C@@H]2[C@H](C=C(F)C#N)C2(C)C)c(F)c1F |
| InChI | InChI=1S/C19H14F5NO2/c1-4-5-10-14(21)16(23)11(17(24)15(10)22)8-27-18(26)13-12(19(13,2)3)6-9(20)7-25/h5-6,12-13H,1,8H2,2-3H3/t12-,13-/m0/s1 |
| InChIKey | LWZLLBILVHITTR-STQMWFEESA-N |
| XLogP | 4.73 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|