C21H21F4NO2S — CID 123250465
[2,3,5,6-tetrafluoro-4-(methylsulfanylmethyl)phenyl]methyl 3-(2-cyanopenta-1,3-dienyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 123250465) has the molecular formula C21H21F4NO2S and a molecular weight of 427.46 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(methylsulfanylmethyl)phenyl]methyl 3-(2-cyanopenta-1,3-dienyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | [2,3,5,6-tetrafluoro-4-(methylsulfanylmethyl)phenyl]methyl 3-(2-cyanopenta-1,3-dienyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 123250465 |
| Molecular Formula | C21H21F4NO2S |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(methylsulfanylmethyl)phenyl]methyl 3-(2-cyanopenta-1,3-dienyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC=CC(C#N)=CC1C(C(=O)OCc2c(F)c(F)c(CSC)c(F)c2F)C1(C)C |
| InChI | InChI=1S/C21H21F4NO2S/c1-5-6-11(8-26)7-14-15(21(14,2)3)20(27)28-9-12-16(22)18(24)13(10-29-4)19(25)17(12)23/h5-7,14-15H,9-10H2,1-4H3 |
| InChIKey | LNVBFVMIBCOENN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|