C19H21NO4 — CID 141238676
benzyl 3-(1-acetyloxy-2-cyanoprop-2-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 141238676) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is benzyl 3-(1-acetyloxy-2-cyanoprop-2-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | benzyl 3-(1-acetyloxy-2-cyanoprop-2-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 141238676 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | benzyl 3-(1-acetyloxy-2-cyanoprop-2-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | C=C(C#N)C(OC(C)=O)C1C(C(=O)OCc2ccccc2)C1(C)C |
| InChI | InChI=1S/C19H21NO4/c1-12(10-20)17(24-13(2)21)15-16(19(15,3)4)18(22)23-11-14-8-6-5-7-9-14/h5-9,15-17H,1,11H2,2-4H3 |
| InChIKey | YTXIITONGUUKBP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|